|
CAS#: 5465-38-3 Product: 3,4-Diphenyloxolane-2,5-Dione No suppilers available for the product. |
| Name | 3,4-Diphenyloxolane-2,5-Dione |
|---|---|
| Synonyms | (3R,4R)-3,4-Di(Phenyl)Tetrahydrofuran-2,5-Dione; (3R,4R)-3,4-Di(Phenyl)Tetrahydrofuran-2,5-Quinone; 2,5-Furandione, Dihydro-3,4-Diphenyl-, Trans- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.27 |
| CAS Registry Number | 5465-38-3 |
| SMILES | [C@H]2(C1=CC=CC=C1)[C@@H](C(=O)OC2=O)C3=CC=CC=C3 |
| InChI | 1S/C16H12O3/c17-15-13(11-7-3-1-4-8-11)14(16(18)19-15)12-9-5-2-6-10-12/h1-10,13-14H/t13-,14-/m0/s1 |
| InChIKey | UWDJRACNZVFLEC-KBPBESRZSA-N |
| Density | 1.254g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.29°C at 760 mmHg (Cal.) |
| Flash point | 210.764°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Diphenyloxolane-2,5-Dione |