Online Database of Chemicals from Around the World
|
CAS#: 54661-53-9 Product: 6,6'-Methylenebis[1,1,3,3-Tetramethylindan-5-Ol] No suppilers available for the product. |
| Name | 6,6'-Methylenebis[1,1,3,3-Tetramethylindan-5-Ol] |
|---|---|
| Synonyms | 6-[(6-Hydroxy-1,1,3,3-Tetramethyl-Indan-5-Yl)Methyl]-1,1,3,3-Tetramethyl-Indan-5-Ol; 6-[(6-Hydroxy-1,1,3,3-Tetramethyl-5-Indanyl)Methyl]-1,1,3,3-Tetramethyl-5-Indanol |
| Molecular Structure | ![CAS#: 54661-53-9, 6,6'-Methylenebis[1,1,3,3-Tetramethylindan-5-Ol]](/moreStructures/54661-53-9.gif) |
| Molecular Formula | C27H36O2 |
| Molecular Weight | 392.58 |
| CAS Registry Number | 54661-53-9 |
| EINECS | 259-282-0 |
| SMILES | C1=C(C(=CC2=C1C(CC2(C)C)(C)C)O)CC4=CC3=C(C(CC3(C)C)(C)C)C=C4O |
| InChI | 1S/C27H36O2/c1-24(2)14-26(5,6)20-12-22(28)16(10-18(20)24)9-17-11-19-21(13-23(17)29)27(7,8)15-25(19,3)4/h10-13,28-29H,9,14-15H2,1-8H3 |
| InChIKey | COLYSLCNGKYMCR-UHFFFAOYSA-N |
| Density | 1.04g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.838°C at 760 mmHg (Cal.) |
| Flash point | 212.175°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,6'-Methylenebis[1,1,3,3-Tetramethylindan-5-Ol] |