|
CAS#: 5468-04-2 Product: 5-Methyl-2-(6-Methyl-1-Cyclohex-3-Enyl)-5-Nitro-1,3-Dioxane No suppilers available for the product. |
| Name | 5-Methyl-2-(6-Methyl-1-Cyclohex-3-Enyl)-5-Nitro-1,3-Dioxane |
|---|---|
| Synonyms | Nsc25474 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 |
| CAS Registry Number | 5468-04-2 |
| SMILES | CC1([N+]([O-])=O)COC(OC1)C2CC=CCC2C |
| InChI | 1S/C12H19NO4/c1-9-5-3-4-6-10(9)11-16-7-12(2,8-17-11)13(14)15/h3-4,9-11H,5-8H2,1-2H3 |
| InChIKey | NIYFQKGUYGGEDO-UHFFFAOYSA-N |
| Density | 1.151g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.02°C at 760 mmHg (Cal.) |
| Flash point | 138.074°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-2-(6-Methyl-1-Cyclohex-3-Enyl)-5-Nitro-1,3-Dioxane |