|
CAS#: 54757-59-4 Product: Motretinide No suppilers available for the product. |
| Name | Motretinide |
|---|---|
| Synonyms | N-Ethyl-9-(4-Methoxy-2,3,6-Trimethylphenyl)-3,7-Dimethylnona-2,4,6,8-Tetraenamide; (2E,4E,6E,8E)-N-Ethyl-9-(4-Methoxy-2,3,6-Trimethyl-Phenyl)-3,7-Dimethyl-Nona-2,4,6,8-Tetraenamide; N-Ethyl-9-(4-Methoxy-2,3,6-Trimethyl-Phenyl)-3,7-Dimethyl-Nona-2,4,6,8-Tetraenamide |
| Molecular Structure | ![]() |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.50 |
| CAS Registry Number | 54757-59-4 |
| SMILES | C1=C(C(=C(C(=C1C)\C=C\C(=C\C=C\C(=C\C(NCC)=O)C)C)C)C)OC |
| InChI | 1S/C23H31NO2/c1-8-24-23(25)14-17(3)11-9-10-16(2)12-13-21-18(4)15-22(26-7)20(6)19(21)5/h9-15H,8H2,1-7H3,(H,24,25)/b11-9+,13-12+,16-10+,17-14+ |
| InChIKey | IYIYMCASGKQOCZ-DJRRULDNSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 560.3±42.0°C at 760 mmHg (Cal.) |
| Flash point | 292.7±27.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Motretinide |