|
CAS#: 54812-31-6 Product: Carboxyfenitrothion No suppilers available for the product. |
| Name | Carboxyfenitrothion |
|---|---|
| Synonyms | 5-Dimethoxyphosphinothioyloxy-2-Nitro-Benzoic Acid; 5-Dimethoxythiophosphoryloxy-2-Nitro-Benzoic Acid; 5-((Dimethoxyphosphinothioyl)Oxy)-2-Nitrobenzoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10NO7PS |
| Molecular Weight | 307.21 |
| CAS Registry Number | 54812-31-6 |
| SMILES | C1=C(O[P](=S)(OC)OC)C=CC(=C1C(=O)O)[N+]([O-])=O |
| InChI | 1S/C9H10NO7PS/c1-15-18(19,16-2)17-6-3-4-8(10(13)14)7(5-6)9(11)12/h3-5H,1-2H3,(H,11,12) |
| InChIKey | VQQKSYZYVZFNSY-UHFFFAOYSA-N |
| Density | 1.543g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.097°C at 760 mmHg (Cal.) |
| Flash point | 218.149°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Carboxyfenitrothion |