|
CAS#: 54812-66-7 Product: 4-[[2-(Diethylammonio)Ethoxy]Carbonyl]Anilinium Hydrogen Phosphate No suppilers available for the product. |
| Name | 4-[[2-(Diethylammonio)Ethoxy]Carbonyl]Anilinium Hydrogen Phosphate |
|---|---|
| Synonyms | 4-Aminobenzoic Acid 2-Diethylaminoethyl Ester; Phosphoric Acid; P-((2-(Diethylammonio)Ethoxy)Carbonyl)Anilinium Hydrogen Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H23N2O6P |
| Molecular Weight | 334.31 |
| CAS Registry Number | 54812-66-7 |
| EINECS | 259-358-3 |
| SMILES | O=[P](O)(O)O.C1=C(C(OCCN(CC)CC)=O)C=CC(=C1)N |
| InChI | 1S/C13H20N2O2.H3O4P/c1-3-15(4-2)9-10-17-13(16)11-5-7-12(14)8-6-11;1-5(2,3)4/h5-8H,3-4,9-10,14H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | NPBISBZNYVWJOL-UHFFFAOYSA-N |
| Boiling point | 373.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 179.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[[2-(Diethylammonio)Ethoxy]Carbonyl]Anilinium Hydrogen Phosphate |