|
CAS#: 54874-20-3 Product: Zinc Toluate No suppilers available for the product. |
| Name | Zinc Toluate |
|---|---|
| Synonyms | Benzoic Acid, 4-Methyl-, Zinc Salt; Zinc P-Toluate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14O4Zn |
| Molecular Weight | 335.66 |
| CAS Registry Number | 54874-20-3 |
| EINECS | 245-563-5 |
| SMILES | C1=CC(=CC=C1C([O-])=O)C.C2=CC(=CC=C2C([O-])=O)C.[Zn++] |
| InChI | 1S/2C8H8O2.Zn/c2*1-6-2-4-7(5-3-6)8(9)10;/h2*2-5H,1H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | RYOLIMKPFQALMC-UHFFFAOYSA-L |
| Boiling point | 275.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 124.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Zinc Toluate |