|
CAS#: 54890-03-8 Product: Cyclohexanedodecol No suppilers available for the product. |
| Name | Cyclohexanedodecol |
|---|---|
| Synonyms | Cyclohexanedodecol; Nsc243155 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12O12 |
| Molecular Weight | 276.15 |
| CAS Registry Number | 54890-03-8 |
| SMILES | OC1(O)C(O)(O)C(O)(O)C(O)(O)C(C1(O)O)(O)O |
| InChI | 1S/C6H12O12/c7-1(8)2(9,10)4(13,14)6(17,18)5(15,16)3(1,11)12/h7-18H |
| InChIKey | MZIPHGCOJCDHPI-UHFFFAOYSA-N |
| Density | 4.536g/cm3 (Cal.) |
|---|---|
| Boiling point | 137.371°C at 760 mmHg (Cal.) |
| Flash point | 31.994°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cyclohexanedodecol |