|
CAS#: 549-76-8 Product: 16alpha-Methylyohimban No suppilers available for the product. |
| Name | 16alpha-Methylyohimban |
|---|---|
| Synonyms | 4-23-00-01650 (Beilstein Handbook Reference); Brn 0091189; Yohimban, 16-Alpha-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 |
| CAS Registry Number | 549-76-8 |
| SMILES | [C@H]34C2=C(C1=CC=CC=C1[NH]2)CCN3C[C@H]5[C@H](C4)[C@H](CCC5)C |
| InChI | 1S/C20H26N2/c1-13-5-4-6-14-12-22-10-9-16-15-7-2-3-8-18(15)21-20(16)19(22)11-17(13)14/h2-3,7-8,13-14,17,19,21H,4-6,9-12H2,1H3/t13-,14-,17+,19-/m0/s1 |
| InChIKey | NAAXUJVMRKKKAH-PDVMFTSQSA-N |
| Density | 1.168g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.097°C at 760 mmHg (Cal.) |
| Flash point | 230.849°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16alpha-Methylyohimban |