|
CAS#: 54965-33-2 Product: 3,3-Dimethyl-4-Phenyl-1-(2-Phenylethyl)-2-Azetidinone No suppilers available for the product. |
| Name | 3,3-Dimethyl-4-Phenyl-1-(2-Phenylethyl)-2-Azetidinone |
|---|---|
| Synonyms | 3,3-Dimethyl-4-phenyl-1-(2-phenylethyl)-2-azetidinone # |
| Molecular Structure | ![]() |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 |
| CAS Registry Number | 54965-33-2 |
| SMILES | O=C3N(CCc1ccccc1)C(c2ccccc2)C3(C)C |
| InChI | 1S/C19H21NO/c1-19(2)17(16-11-7-4-8-12-16)20(18(19)21)14-13-15-9-5-3-6-10-15/h3-12,17H,13-14H2,1-2H3 |
| InChIKey | YDNTVOHUWKXXAR-UHFFFAOYSA-N |
| Density | 1.077g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.93°C at 760 mmHg (Cal.) |
| Flash point | 179.513°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Dimethyl-4-Phenyl-1-(2-Phenylethyl)-2-Azetidinone |