|
CAS#: 550-94-7 Product: alpha-Amino-2-[(2-Amino-2-Carboxyethyl)Thio]-1H-Indole-3-Propionic Acid No suppilers available for the product. |
| Name | alpha-Amino-2-[(2-Amino-2-Carboxyethyl)Thio]-1H-Indole-3-Propionic Acid |
|---|---|
| Synonyms | (2S)-2-Amino-3-[2-(2-Amino-3-Hydroxy-3-Oxo-Propyl)Sulfanyl-1H-Indol-3-Yl]Propanoic Acid; (2S)-2-Amino-3-[2-[(2-Amino-3-Hydroxy-3-Oxopropyl)Thio]-1H-Indol-3-Yl]Propanoic Acid; (2S)-2-Amino-3-[2-[(2-Amino-3-Hydroxy-3-Keto-Propyl)Thio]-1H-Indol-3-Yl]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 |
| CAS Registry Number | 550-94-7 |
| SMILES | [C@H](C(=O)O)(N)CC1=C([NH]C2=CC=CC=C12)SCC(C(=O)O)N |
| InChI | 1S/C14H17N3O4S/c15-9(13(18)19)5-8-7-3-1-2-4-11(7)17-12(8)22-6-10(16)14(20)21/h1-4,9-10,17H,5-6,15-16H2,(H,18,19)(H,20,21)/t9-,10?/m0/s1 |
| InChIKey | MGVCAXMLCYZGFI-RGURZIINSA-N |
| Density | 1.518g/cm3 (Cal.) |
|---|---|
| Boiling point | 628.995°C at 760 mmHg (Cal.) |
| Flash point | 334.204°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Amino-2-[(2-Amino-2-Carboxyethyl)Thio]-1H-Indole-3-Propionic Acid |