|
CAS#: 55000-38-9 Product: N-(3-Nitrophenyl)-3-Phenylacrylamide No suppilers available for the product. |
| Name | N-(3-Nitrophenyl)-3-Phenylacrylamide |
|---|---|
| Synonyms | CBDivE_001559; ZINC00038706 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 |
| CAS Registry Number | 55000-38-9 |
| SMILES | O=C(Nc1cccc(c1)[N+]([O-])=O)C=Cc2ccccc2 |
| InChI | 1S/C15H12N2O3/c18-15(10-9-12-5-2-1-3-6-12)16-13-7-4-8-14(11-13)17(19)20/h1-11H,(H,16,18) |
| InChIKey | WGBZHIZJROMONE-UHFFFAOYSA-N |
| Density | 1.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.413°C at 760 mmHg (Cal.) |
| Flash point | 252.208°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3-Nitrophenyl)-3-Phenylacrylamide |