|
CAS#: 55030-60-9 Product: 1,1,4,8-Tetramethyl-1,2,3,5,6,7-Hexahydro-S-Indacene No suppilers available for the product. |
| Name | 1,1,4,8-Tetramethyl-1,2,3,5,6,7-Hexahydro-S-Indacene |
|---|---|
| Synonyms | 1,1,4,8-Tetramethyl-1,2,3,5,6,7-hexahydro-S-indacene # |
| Molecular Structure | ![]() |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 |
| CAS Registry Number | 55030-60-9 |
| SMILES | c12c(c3c(c(c1CCC2)C)CCC3(C)C)C |
| InChI | 1S/C16H22/c1-10-12-6-5-7-13(12)11(2)15-14(10)8-9-16(15,3)4/h5-9H2,1-4H3 |
| InChIKey | VWKJXBJVRZWIED-UHFFFAOYSA-N |
| Density | 0.981g/cm3 (Cal.) |
|---|---|
| Boiling point | 287.528°C at 760 mmHg (Cal.) |
| Flash point | 124.563°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,4,8-Tetramethyl-1,2,3,5,6,7-Hexahydro-S-Indacene |