|
CAS#: 5505-84-0 Product: 4-Methyl-4-(4-Methylcyclohexyl)Pentan-2-One No suppilers available for the product. |
| Name | 4-Methyl-4-(4-Methylcyclohexyl)Pentan-2-One |
|---|---|
| Synonyms | 2-Pentanone, 4-Methyl-4-(4-Methylcyclohexyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 |
| CAS Registry Number | 5505-84-0 |
| EINECS | 226-849-9 |
| SMILES | C(C(C1CCC(CC1)C)(C)C)C(=O)C |
| InChI | 1S/C13H24O/c1-10-5-7-12(8-6-10)13(3,4)9-11(2)14/h10,12H,5-9H2,1-4H3 |
| InChIKey | FIHXKZYLIWLRND-UHFFFAOYSA-N |
| Density | 0.881g/cm3 (Cal.) |
|---|---|
| Boiling point | 248.858°C at 760 mmHg (Cal.) |
| Flash point | 85.301°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-4-(4-Methylcyclohexyl)Pentan-2-One |