|
CAS#: 55059-26-2 Product: 1-Methyl-3,5-Bis(3-Methyl-3-Buten-1-Yl)Benzene No suppilers available for the product. |
| Name | 1-Methyl-3,5-Bis(3-Methyl-3-Buten-1-Yl)Benzene |
|---|---|
| Synonyms | 1-Methyl-3,5-bis(3-methyl-3-butenyl)benzene # |
| Molecular Structure | ![]() |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.37 |
| CAS Registry Number | 55059-26-2 |
| SMILES | C(=C)(\CCc1cc(cc(c1)CCC(=C)\C)C)C |
| InChI | 1S/C17H24/c1-13(2)6-8-16-10-15(5)11-17(12-16)9-7-14(3)4/h10-12H,1,3,6-9H2,2,4-5H3 |
| InChIKey | ZDATUOSTZOHMBC-UHFFFAOYSA-N |
| Density | 0.878g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.567°C at 760 mmHg (Cal.) |
| Flash point | 137.062°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-3,5-Bis(3-Methyl-3-Buten-1-Yl)Benzene |