|
CAS#: 55125-23-0 Product: Methyl 3,5-Dicyclohexyl-4-Hydroxybenzoate No suppilers available for the product. |
| Name | Methyl 3,5-Dicyclohexyl-4-Hydroxybenzoate |
|---|---|
| Synonyms | Methyl 3,5-dicyclohexyl-4-hydroxybenzoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.43 |
| CAS Registry Number | 55125-23-0 |
| SMILES | O=C(OC)c1cc(c(O)c(c1)C2CCCCC2)C3CCCCC3 |
| InChI | 1S/C20H28O3/c1-23-20(22)16-12-17(14-8-4-2-5-9-14)19(21)18(13-16)15-10-6-3-7-11-15/h12-15,21H,2-11H2,1H3 |
| InChIKey | MZMTWFVMIMBDGQ-UHFFFAOYSA-N |
| Density | 1.098g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.127°C at 760 mmHg (Cal.) |
| Flash point | 143.968°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3,5-Dicyclohexyl-4-Hydroxybenzoate |