|
CAS#: 5513-72-4 Product: N-Formyl-L-Aspartic acid 4-benzyl ester No suppilers available for the product. |
| Name | N-Formyl-L-Aspartic acid 4-benzyl ester |
|---|---|
| Synonyms | (3S)-4-(Benzyloxy)-3-Formamido-4-Keto-Butyric Acid; 4-Benzyl Hydrogen N-Formyl-L-Aspartate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 |
| CAS Registry Number | 5513-72-4 |
| EINECS | 226-858-8 |
| SMILES | [C@H](CC(=O)O)(C(OCC1=CC=CC=C1)=O)NC=O |
| InChI | 1S/C12H13NO5/c14-8-13-10(6-11(15)16)12(17)18-7-9-4-2-1-3-5-9/h1-5,8,10H,6-7H2,(H,13,14)(H,15,16)/t10-/m0/s1 |
| InChIKey | VBVOXHBCUVICCE-JTQLQIEISA-N |
| Density | 1.302g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.27°C at 760 mmHg (Cal.) |
| Flash point | 274.498°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Formyl-L-Aspartic acid 4-benzyl ester |