Online Database of Chemicals from Around the World
|
CAS#: 5516-51-8 Product: 2-Benzylthio-4,6-Bis(Trichloromethyl)-1,3,5-Triazine No suppilers available for the product. |
| Name | 2-Benzylthio-4,6-Bis(Trichloromethyl)-1,3,5-Triazine |
|---|---|
| Synonyms | 2-(Phenylmethylthio)-4,6-Bis(Trichloromethyl)-1,3,5-Triazine; 2-(Benzylthio)-4,6-Bis(Trichloromethyl)-S-Triazine; 1,3,5-Triazine, 2-[(Phenylmethyl)Thio]-4,6-Bis(Trichloromethyl)- |
| Molecular Structure |  |
| Molecular Formula | C12H7Cl6N3S |
| Molecular Weight | 437.99 |
| CAS Registry Number | 5516-51-8 |
| SMILES | C1=CC=CC=C1CSC2=NC(=NC(=N2)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | 1S/C12H7Cl6N3S/c13-11(14,15)8-19-9(12(16,17)18)21-10(20-8)22-6-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | QEMUVGKPNFMGAZ-UHFFFAOYSA-N |
| Density | 1.68g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.947°C at 760 mmHg (Cal.) |
| Flash point | 245.273°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Benzylthio-4,6-Bis(Trichloromethyl)-1,3,5-Triazine |