Online Database of Chemicals from Around the World
|
CAS#: 5525-36-0 Product: Thalsimine No suppilers available for the product. |
| Name | Thalsimine |
|---|---|
| Synonyms | Thalsimine; Thalcimine |
| Molecular Structure |  |
| Molecular Formula | C38H40N2O7 |
| Molecular Weight | 636.74 |
| CAS Registry Number | 5525-36-0 |
| SMILES | [C@H]26C1=C(C(=C(C(=C1CCN2C)OC)OC)OC)OC3=C(C=C4C(=C3)C(=NCC4)CC7=CC=C(OC5=C(C=CC(=C5)C6)OC)C=C7)OC |
| InChI | 1S/C38H40N2O7/c1-40-16-14-26-34-29(40)18-23-9-12-30(41-2)32(19-23)46-25-10-7-22(8-11-25)17-28-27-21-33(31(42-3)20-24(27)13-15-39-28)47-36(34)38(45-6)37(44-5)35(26)43-4/h7-12,19-21,29H,13-18H2,1-6H3/t29-/m0/s1 |
| InChIKey | YWNUNVSMOKMJMG-LJAQVGFWSA-N |
| Density | 1.276g/cm3 (Cal.) |
|---|---|
| Boiling point | 750.921°C at 760 mmHg (Cal.) |
| Flash point | 407.942°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Thalsimine |