|
CAS#: 553-00-4 Product: 2-Naphthylamine Acetate No suppilers available for the product. |
| Name | 2-Naphthylamine Acetate |
|---|---|
| Synonyms | Acetic Acid; 2-Naphthalenamine; Acetic Acid; 2-Naphthylamine; Ethanoic Acid; Naphthalen-2-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| CAS Registry Number | 553-00-4 |
| EINECS | 209-030-0 |
| SMILES | CC(=O)O.C1=C2C(=CC=C1N)C=CC=C2 |
| InChI | 1S/C10H9N.C2H4O2/c11-10-6-5-8-3-1-2-4-9(8)7-10;1-2(3)4/h1-7H,11H2;1H3,(H,3,4) |
| InChIKey | IHTSMKSDNSSELM-UHFFFAOYSA-N |
| Boiling point | 307.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 157.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Naphthylamine Acetate |