|
CAS#: 553-58-2 Product: 2-Isobutylaminoethyl 3-aminobenzoate hydrochloride No suppilers available for the product. |
| Name | 2-Isobutylaminoethyl 3-aminobenzoate hydrochloride |
|---|---|
| Synonyms | 2-(Isobutylamino)Ethyl 3-Aminobenzoate Hydrochloride; 3-Aminobenzoic Acid 2-(Isobutylamino)Ethyl Ester Hydrochloride; 2-(Isobutylamino)Ethanol M-Aminobenzoate Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.77 |
| CAS Registry Number | 553-58-2 |
| SMILES | [H+].C1=C(C(OCCNCC(C)C)=O)C=CC=C1N.[Cl-] |
| InChI | 1S/C13H20N2O2.ClH/c1-10(2)9-15-6-7-17-13(16)11-4-3-5-12(14)8-11;/h3-5,8,10,15H,6-7,9,14H2,1-2H3;1H |
| InChIKey | HKUYLJOKQXCBDY-UHFFFAOYSA-N |
| Boiling point | 383.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 185.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isobutylaminoethyl 3-aminobenzoate hydrochloride |