CAS#: 55353-32-7 Product: Herbicidin B No suppilers available for the product. |
Name | Herbicidin B |
---|---|
Synonyms | Herbicidin B |
Molecular Structure | ![]() |
Molecular Formula | C18H23N5O9 |
Molecular Weight | 453.41 |
CAS Registry Number | 55353-32-7 |
SMILES | [C@H]1(O[C@H]2[C@@H]([C@H]1OC)O[C@@]3([C@@H](C2)O[C@@H]([C@H]([C@@H]3O)O)C(=O)OC)O)[N]4C=NC5=C4N=CN=C5N |
InChI | 1S/C18H23N5O9/c1-28-12-10-6(30-16(12)23-5-22-8-14(19)20-4-21-15(8)23)3-7-18(27,32-10)13(25)9(24)11(31-7)17(26)29-2/h4-7,9-13,16,24-25,27H,3H2,1-2H3,(H2,19,20,21)/t6-,7-,9-,10+,11+,12-,13+,16-,18-/m1/s1 |
InChIKey | GZBSICLBZYSADI-DHNWSQMASA-N |
Density | 2.002g/cm3 (Cal.) |
---|---|
Boiling point | 746.598°C at 760 mmHg (Cal.) |
Flash point | 405.328°C (Cal.) |
Market Analysis Reports |
List of Reports Available for Herbicidin B |