|
CAS#: 55492-43-8 Product: Poly(acrylic acid) iron salt No suppilers available for the product. |
| Name | Poly(acrylic acid) iron salt |
|---|---|
| Synonyms | Ferrous Prop-2-Enoate; Ferrous Acrylate; Feracryl |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6FeO4 |
| Molecular Weight | 197.96 |
| CAS Registry Number | 55492-43-8 |
| SMILES | O=C([O-])C=C.O=C([O-])C=C.[Fe++] |
| InChI | 1S/2C3H4O2.Fe/c2*1-2-3(4)5;/h2*2H,1H2,(H,4,5);/q;;+2/p-2 |
| InChIKey | GNOZLGOOOBMHRC-UHFFFAOYSA-L |
| Boiling point | 141°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 61.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Poly(acrylic acid) iron salt |