|
CAS#: 5560-73-6 Product: Mimbane No suppilers available for the product. |
| Name | Mimbane |
|---|---|
| Synonyms | W 2291 A; 1-Methylyohimban Hydrochloride; 13-Methyl-1,2,3,4,4A,5,7,8,13,13B,14,14A-Dodecahydrobenz(G)Indolo(2,3-A)Chinolizin Hydrochlorid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H27ClN2 |
| Molecular Weight | 330.90 |
| CAS Registry Number | 5560-73-6 |
| SMILES | [H+].C2=C1C5=C([N](C1=CC=C2)C)CC3N(CC4C(C3)CCCC4)C5.[Cl-] |
| InChI | 1S/C20H26N2.ClH/c1-21-19-9-5-4-8-17(19)18-13-22-12-15-7-3-2-6-14(15)10-16(22)11-20(18)21;/h4-5,8-9,14-16H,2-3,6-7,10-13H2,1H3;1H |
| InChIKey | VTDJLTSSORYGEL-UHFFFAOYSA-N |
| Boiling point | 458.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 231.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mimbane |