|
CAS#: 55699-19-9 Product: 2,2-Dimethyl-5-Tert-Butyl-1,3-Benzodioxole No suppilers available for the product. |
| Name | 2,2-Dimethyl-5-Tert-Butyl-1,3-Benzodioxole |
|---|---|
| Synonyms | 2,2-Dimethyl-5-Tert-Butyl-1,3-Benzodioxole; 2-Dbbd; Ai3-14401 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 |
| CAS Registry Number | 55699-19-9 |
| SMILES | C1=CC2=C(C=C1C(C)(C)C)OC(O2)(C)C |
| InChI | 1S/C13H18O2/c1-12(2,3)9-6-7-10-11(8-9)15-13(4,5)14-10/h6-8H,1-5H3 |
| InChIKey | ZIRCLOZJQPLYSS-UHFFFAOYSA-N |
| Density | 1.003g/cm3 (Cal.) |
|---|---|
| Boiling point | 251.787°C at 760 mmHg (Cal.) |
| Flash point | 111.268°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dimethyl-5-Tert-Butyl-1,3-Benzodioxole |