Online Database of Chemicals from Around the World
|
CAS#: 55712-60-2 Product: 3-(2-Naphtyl)Benzo[b]Thiophene No suppilers available for the product. |
| Name | 3-(2-Naphtyl)Benzo[b]Thiophene |
|---|---|
| Synonyms | 3-(2-Naphthyl)Benzothiophene; Nsc163930; 3-(2-Naphthyl)-1-Thiaindene |
| Molecular Structure | ![CAS#: 55712-60-2, 3-(2-Naphtyl)Benzo[b]Thiophene](/moreStructures/55712-60-2.gif) |
| Molecular Formula | C18H12S |
| Molecular Weight | 260.35 |
| CAS Registry Number | 55712-60-2 |
| SMILES | C1=CC=CC2=C1SC=C2C3=CC4=C(C=C3)C=CC=C4 |
| InChI | 1S/C18H12S/c1-2-6-14-11-15(10-9-13(14)5-1)17-12-19-18-8-4-3-7-16(17)18/h1-12H |
| InChIKey | BZUUVEAFJXNFER-UHFFFAOYSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.833°C at 760 mmHg (Cal.) |
| Flash point | 168.955°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-(2-Naphtyl)Benzo[b]Thiophene |