|
CAS#: 55720-33-7 Product: 1,2,5-Trichloronaphthalene No suppilers available for the product. |
| Name | 1,2,5-Trichloronaphthalene |
|---|---|
| Synonyms | Naphthalene, 1,2,5-Trichloro-; Naphthalene, 1,2,5-Trichloro |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5Cl3 |
| Molecular Weight | 231.51 |
| CAS Registry Number | 55720-33-7 |
| SMILES | C2=CC1=C(C(=CC=C1C(=C2)Cl)Cl)Cl |
| InChI | 1S/C10H5Cl3/c11-8-3-1-2-7-6(8)4-5-9(12)10(7)13/h1-5H |
| InChIKey | MMHZKSMAFILONG-UHFFFAOYSA-N |
| Density | 1.452g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.708°C at 760 mmHg (Cal.) |
| Flash point | 228.346°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,5-Trichloronaphthalene |