|
CAS#: 5573-15-9 Product: (18alpha)-11-Oxo-alpha-Neooleana-3(5),12-Dien-30-Oic Acid Methyl Ester No suppilers available for the product. |
| Name | (18alpha)-11-Oxo-alpha-Neooleana-3(5),12-Dien-30-Oic Acid Methyl Ester |
|---|---|
| Synonyms | Methyl 11-Oxo-18-Alpha-A-Neo-Oleana-3,12-Dien-30-Oate |
| Molecular Structure | ![]() |
| Molecular Formula | C31H46O3 |
| Molecular Weight | 466.70 |
| CAS Registry Number | 5573-15-9 |
| SMILES | [C@@]23([C@@H]([C@@]1(C(=C(CC1)C(C)C)CC2)C)C(=O)C=C4[C@]3(CC[C@@]5([C@@H]4C[C@](CC5)(C(OC)=O)C)C)C)C |
| InChI | 1S/C31H46O3/c1-19(2)20-9-11-29(5)21(20)10-12-31(7)25(29)24(32)17-22-23-18-28(4,26(33)34-8)14-13-27(23,3)15-16-30(22,31)6/h17,19,23,25H,9-16,18H2,1-8H3/t23-,25-,27-,28+,29+,30-,31-/m1/s1 |
| InChIKey | KLDHTSBPVUVXQQ-SBSPXKCJSA-N |
| Density | 1.082g/cm3 (Cal.) |
|---|---|
| Boiling point | 537.647°C at 760 mmHg (Cal.) |
| Flash point | 224.557°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (18alpha)-11-Oxo-alpha-Neooleana-3(5),12-Dien-30-Oic Acid Methyl Ester |