|
CAS#: 55779-66-3 Product: 2,3-Diamino-2,3-Dideoxyglucose No suppilers available for the product. |
| Name | 2,3-Diamino-2,3-Dideoxyglucose |
|---|---|
| Synonyms | (2R,3R,4S,5R)-2,3-Diamino-4,5,6-Trihydroxy-Hexanal; 2,3-Dideoxy-2,3-Diamino-D-Glucose; D-Glucose, 2,3-Diamino-2,3-Dideoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H14N2O4 |
| Molecular Weight | 178.19 |
| CAS Registry Number | 55779-66-3 |
| SMILES | [C@H](C=O)([C@H]([C@H](O)[C@H](O)CO)N)N |
| InChI | 1S/C6H14N2O4/c7-3(1-9)5(8)6(12)4(11)2-10/h1,3-6,10-12H,2,7-8H2/t3-,4+,5+,6+/m0/s1 |
| InChIKey | MHLLXJQXRRXAQH-SLPGGIOYSA-N |
| Density | 1.411g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.043°C at 760 mmHg (Cal.) |
| Flash point | 256.822°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Diamino-2,3-Dideoxyglucose |