Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Simtrazene |
|---|---|
| Synonyms | N-Methyl-N-(Methyl-Phenyl-Amino)Azo-Aniline; N-Methyl-N-(Methyl-Phenylamino)Azoaniline; Methyl-(Methyl-Phenyl-Amino)Azo-Phenyl-Amine |
| Molecular Structure |  |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 |
| CAS Registry Number | 5579-27-1 |
| SMILES | C2=C(N(\N=N\N(C1=CC=CC=C1)C)C)C=CC=C2 |
| InChI | 1S/C14H16N4/c1-17(13-9-5-3-6-10-13)15-16-18(2)14-11-7-4-8-12-14/h3-12H,1-2H3/b16-15+ |
| InChIKey | WRINSSLBPNLASA-FOCLMDBBSA-N |
| Density | 1.044g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.334°C at 760 mmHg (Cal.) |
| Flash point | 154.79°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Simtrazene |