|
CAS#: 5585-60-4 Product: Paranyline Hydrochloride No suppilers available for the product. |
| Name | Paranyline Hydrochloride |
|---|---|
| Synonyms | 4-(Fluoren-9-Ylidenemethyl)Benzamidine Hydrochloride; 4-(9-Fluorenylidenemethyl)Benzamidine Hydrochloride; D05359 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H17ClN2 |
| Molecular Weight | 332.83 |
| CAS Registry Number | 5585-60-4 |
| SMILES | [H+].C3=C2C(C1=CC=CC=C1C2=CC=C3)=CC4=CC=C(C=C4)C(N)=N.[Cl-] |
| InChI | 1S/C21H16N2.ClH/c22-21(23)15-11-9-14(10-12-15)13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20;/h1-13H,(H3,22,23);1H |
| InChIKey | INDZCVYWKNWKIQ-UHFFFAOYSA-N |
| Boiling point | 470.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 238.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Paranyline Hydrochloride |