|
CAS#: 55872-83-8 Product: N,N'-Di(1H-Pyrrol-1-Yl)-1,4-Benzenediamine No suppilers available for the product. |
| Name | N,N'-Di(1H-Pyrrol-1-Yl)-1,4-Benzenediamine |
|---|---|
| Synonyms | Dihydroazarole; N,N'-Di-1H-pyrrol-1-yl-,1,4-benzenediamine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 |
| CAS Registry Number | 55872-83-8 |
| SMILES | C1=CN(C=C1)NC2=CC=C(C=C2)NN3C=CC=C3 |
| InChI | 1S/C14H14N4/c1-2-10-17(9-1)15-13-5-7-14(8-6-13)16-18-11-3-4-12-18/h1-12,15-16H |
| InChIKey | PIWPJSDQCKMNLG-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.0±55.0°C at 760 mmHg (Cal.) |
| Flash point | 201.8±31.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N'-Di(1H-Pyrrol-1-Yl)-1,4-Benzenediamine |