|
CAS#: 5591-57-1 Product: 7,8,9,10-Tetrahydro-4-Methoxy-6H-Cyclohepta[b]Quinolin-11-Amine No suppilers available for the product. |
| Name | 7,8,9,10-Tetrahydro-4-Methoxy-6H-Cyclohepta[b]Quinolin-11-Amine |
|---|---|
| Synonyms | (4-Methoxy-7,8,9,10-Tetrahydro-6H-Cyclohepta[B]Quinolin-11-Yl)Amine; Brn 0403234; Mas 795 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 |
| CAS Registry Number | 5591-57-1 |
| SMILES | C1=CC=C(OC)C2=C1C(=C3C(=N2)CCCCC3)N |
| InChI | 1S/C15H18N2O/c1-18-13-9-5-7-11-14(16)10-6-3-2-4-8-12(10)17-15(11)13/h5,7,9H,2-4,6,8H2,1H3,(H2,16,17) |
| InChIKey | BPRRILISANCROT-UHFFFAOYSA-N |
| Density | 1.167g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.654°C at 760 mmHg (Cal.) |
| Flash point | 228.162°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,8,9,10-Tetrahydro-4-Methoxy-6H-Cyclohepta[b]Quinolin-11-Amine |