Online Database of Chemicals from Around the World
| Name | 1-[3-(5-Acetyl-2,3-Dimethoxy-Phenyl)-4,5-Dimethoxy-Phenyl]Ethanone |
|---|---|
| Synonyms | 1-[3-(5-Acetyl-2,3-Dimethoxy-Phenyl)-4,5-Dimethoxy-Phenyl]Ethanone; 1-[3-(5-Ethanoyl-2,3-Dimethoxy-Phenyl)-4,5-Dimethoxy-Phenyl]Ethanone; Flavanone,5,7-Dihydroxy- |
| Molecular Structure | ![CAS#: 55919-72-7, 1-[3-(5-Acetyl-2,3-Dimethoxy-Phenyl)-4,5-Dimethoxy-Phenyl]Ethanone](/moreStructures/55919-72-7.gif) |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 |
| CAS Registry Number | 55919-72-7 |
| SMILES | C1=C(C(=C(C=C1C(C)=O)OC)OC)C2=C(C(=CC(=C2)C(=O)C)OC)OC |
| InChI | 1S/C20H22O6/c1-11(21)13-7-15(19(25-5)17(9-13)23-3)16-8-14(12(2)22)10-18(24-4)20(16)26-6/h7-10H,1-6H3 |
| InChIKey | UFABOERRPFSOJD-UHFFFAOYSA-N |
| Density | 1.142g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.604°C at 760 mmHg (Cal.) |
| Flash point | 210.397°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[3-(5-Acetyl-2,3-Dimethoxy-Phenyl)-4,5-Dimethoxy-Phenyl]Ethanone |
