|
CAS#: 5592-71-2 Product: Amantadine-N-Mustard No suppilers available for the product. |
| Name | Amantadine-N-Mustard |
|---|---|
| Synonyms | N,N-Bis(2-Chloroethyl)-1-Adamantanamine; 1-Adamantyl-Bis(2-Chloroethyl)Amine; Amantadine-N-Mustard |
| Molecular Structure | ![]() |
| Molecular Formula | C14H23Cl2N |
| Molecular Weight | 276.25 |
| CAS Registry Number | 5592-71-2 |
| SMILES | C(N(C23CC1CC(CC(C1)C2)C3)CCCl)CCl |
| InChI | 1S/C14H23Cl2N/c15-1-3-17(4-2-16)14-8-11-5-12(9-14)7-13(6-11)10-14/h11-13H,1-10H2 |
| InChIKey | XXLZNPXWCIMLFS-UHFFFAOYSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.66°C at 760 mmHg (Cal.) |
| Flash point | 138.658°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Amantadine-N-Mustard |