|
CAS#: 55937-50-3 Product: 2-Chloro-6-Cyclopentyl-4-Nitrophenol No suppilers available for the product. |
| Name | 2-Chloro-6-Cyclopentyl-4-Nitrophenol |
|---|---|
| Synonyms | 2-Chloro-6-Cyclopentyl-4-Nitro-Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 |
| CAS Registry Number | 55937-50-3 |
| EINECS | 259-911-9 |
| SMILES | C1=C([N+]([O-])=O)C=C(C(=C1C2CCCC2)O)Cl |
| InChI | 1S/C11H12ClNO3/c12-10-6-8(13(15)16)5-9(11(10)14)7-3-1-2-4-7/h5-7,14H,1-4H2 |
| InChIKey | HDCOPLJVLHIPBO-UHFFFAOYSA-N |
| Density | 1.38g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.627°C at 760 mmHg (Cal.) |
| Flash point | 132.591°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-6-Cyclopentyl-4-Nitrophenol |