|
CAS#: 56046-61-8 Product: N-[2-[(4-Amino-m-Tolyl)Ethylamino]Ethyl]Methanesulphonamide Phosphate No suppilers available for the product. |
| Name | N-[2-[(4-Amino-m-Tolyl)Ethylamino]Ethyl]Methanesulphonamide Phosphate |
|---|---|
| Synonyms | N-[2-[(4-Amino-3-Methyl-Phenyl)-Ethyl-Amino]Ethyl]Methanesulfonamide; Phosphoric Acid; 4-Amino-3-Methyl-N-Ethyl-N-2-Methylsulfonamidoethylaniline Orthophosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H24N3O6PS |
| Molecular Weight | 369.37 |
| CAS Registry Number | 56046-61-8 |
| EINECS | 259-956-4 |
| SMILES | C1=C(C(=CC=C1N(CCN[S](=O)(=O)C)CC)N)C.O=[P](O)(O)O |
| InChI | 1S/C12H21N3O2S.H3O4P/c1-4-15(8-7-14-18(3,16)17)11-5-6-12(13)10(2)9-11;1-5(2,3)4/h5-6,9,14H,4,7-8,13H2,1-3H3;(H3,1,2,3,4) |
| InChIKey | VVJXMKISHKLVFK-UHFFFAOYSA-N |
| Boiling point | 455°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 229°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[2-[(4-Amino-m-Tolyl)Ethylamino]Ethyl]Methanesulphonamide Phosphate |