|
CAS#: 56104-03-1 Product: gamma-Glutamyl Dopamine No suppilers available for the product. |
| Name | gamma-Glutamyl Dopamine |
|---|---|
| Synonyms | (2S)-5-Amino-2-[2-(3,4-Dihydroxyphenyl)Ethylamino]-5-Oxo-Pentanoic Acid; (2S)-5-Amino-2-[2-(3,4-Dihydroxyphenyl)Ethylamino]-5-Keto-Valeric Acid; L-Glutamine, N-(2-(3,4-Dihydroxyphenyl)Ethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 |
| CAS Registry Number | 56104-03-1 |
| SMILES | [C@@H](NCCC1=CC=C(O)C(=C1)O)(C(=O)O)CCC(=O)N |
| InChI | 1S/C13H18N2O5/c14-12(18)4-2-9(13(19)20)15-6-5-8-1-3-10(16)11(17)7-8/h1,3,7,9,15-17H,2,4-6H2,(H2,14,18)(H,19,20)/t9-/m0/s1 |
| InChIKey | BRFMSFVCMXMBKH-VIFPVBQESA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 646.753°C at 760 mmHg (Cal.) |
| Flash point | 344.944°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for gamma-Glutamyl Dopamine |