| Name | 1,2-Dihydrophenanthrene |
|---|---|
| Synonyms | Brn 1933356; Phenanthrene, 1,2-Dihydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 |
| CAS Registry Number | 56179-83-0 |
| SMILES | C1=CC3=C(C2=C1CCC=C2)C=CC=C3 |
| InChI | 1S/C14H12/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1,3-5,7-10H,2,6H2 |
| InChIKey | DYHJTAONEPZTCO-UHFFFAOYSA-N |
| Density | 1.101g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.247°C at 760 mmHg (Cal.) |
| Flash point | 153.72°C (Cal.) |
| (1) | Frederick D. Lewis, Todd L. Kurth and Rajdeep S. Kalgutkar. , Chem. Commun., 2001, 0, 1372. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2-Dihydrophenanthrene |