|
CAS#: 56286-55-6 Product: Nitroacenaphthene No suppilers available for the product. |
| Name | Nitroacenaphthene |
|---|---|
| Synonyms | Nitroacenaphthene; Acenaphthylene, 1,2-Dihydronitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 |
| CAS Registry Number | 56286-55-6 |
| SMILES | C1=CC=C2C=CC=C3C(CC1=C23)[N+](=O)[O-] |
| InChI | 1S/C12H9NO2/c14-13(15)11-7-9-5-1-3-8-4-2-6-10(11)12(8)9/h1-6,11H,7H2 |
| InChIKey | AVAGDIXDPQCKCQ-UHFFFAOYSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.241°C at 760 mmHg (Cal.) |
| Flash point | 207.526°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nitroacenaphthene |