|
CAS#: 5634-40-2 Product: Levamfetamine Succinate No suppilers available for the product. |
| Name | Levamfetamine Succinate |
|---|---|
| Synonyms | (2R)-1-Phenylpropan-2-Amine; Succinic Acid; [(1R)-1-Methyl-2-Phenyl-Ethyl]Amine; Succinic Acid; Levamfetamine Succinate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 |
| CAS Registry Number | 5634-40-2 |
| SMILES | [C@H](N)(CC1=CC=CC=C1)C.C(C(=O)O)CC(=O)O |
| InChI | 1S/C9H13N.C4H6O4/c1-8(10)7-9-5-3-2-4-6-9;5-3(6)1-2-4(7)8/h2-6,8H,7,10H2,1H3;1-2H2,(H,5,6)(H,7,8)/t8-;/m1./s1 |
| InChIKey | HVANWDSTOFDWRV-DDWIOCJRSA-N |
| Boiling point | 201.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 87.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Levamfetamine Succinate |