Online Database of Chemicals from Around the World
|
CAS#: 56349-25-8 Product: 1a,2,4b,5a,6,7,7a,8-Octahydro-1a,7,7a-trimethyl-Oxireno(c)oxireno(3,4)benz(1,2-f)indole-2,6-diol 6-acetate No suppilers available for the product. |
| Name | 1a,2,4b,5a,6,7,7a,8-Octahydro-1a,7,7a-trimethyl-Oxireno(c)oxireno(3,4)benz(1,2-f)indole-2,6-diol 6-acetate |
|---|---|
| Synonyms | Pr Toxin Imine; Pr-Imine |
| Molecular Structure |  |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 |
| CAS Registry Number | 56349-25-8 |
| SMILES | CC12C5(O1)C(=NC2O)C=C4C3OC3C(C(C4(C5)C)C)OC(=O)C |
| InChI | 1S/C17H21NO5/c1-7-11(21-8(2)19)13-12(22-13)9-5-10-17(6-15(7,9)3)16(4,23-17)14(20)18-10/h5,7,11-14,20H,6H2,1-4H3 |
| InChIKey | SBGVOJKUHUEKNQ-UHFFFAOYSA-N |
| Density | 1.637g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.718°C at 760 mmHg (Cal.) |
| Flash point | 236.667°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1a,2,4b,5a,6,7,7a,8-Octahydro-1a,7,7a-trimethyl-Oxireno(c)oxireno(3,4)benz(1,2-f)indole-2,6-diol 6-acetate |