Online Database of Chemicals from Around the World
|
CAS#: 56519-50-7 Product: 3,3-Bis(1-Methylethyl)-1-(2,2,2-Trifluoroethyl)-2,4-Azetidinedione No suppilers available for the product. |
| Name | 3,3-Bis(1-Methylethyl)-1-(2,2,2-Trifluoroethyl)-2,4-Azetidinedione |
|---|---|
| Synonyms | 3,3-Diisopropyl-1-(2,2,2-Trifluoroethyl)Azetidine-2,4-Dione; 3,3-Diisopropyl-1-(2,2,2-Trifluoroethyl)Azetidine-2,4-Quinone; 2,4-Azetidinedione, 3,3-Bis(1-Methylethyl)-1-(2,2,2-Trifluoroethyl)- |
| Molecular Structure |  |
| Molecular Formula | C11H16F3NO2 |
| Molecular Weight | 251.25 |
| CAS Registry Number | 56519-50-7 |
| SMILES | C(N1C(C(C1=O)(C(C)C)C(C)C)=O)C(F)(F)F |
| InChI | 1S/C11H16F3NO2/c1-6(2)11(7(3)4)8(16)15(9(11)17)5-10(12,13)14/h6-7H,5H2,1-4H3 |
| InChIKey | IKTVMYPKVJHSTB-UHFFFAOYSA-N |
| Density | 1.187g/cm3 (Cal.) |
|---|---|
| Boiling point | 235.359°C at 760 mmHg (Cal.) |
| Flash point | 96.142°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Bis(1-Methylethyl)-1-(2,2,2-Trifluoroethyl)-2,4-Azetidinedione |