|
CAS#: 5653-61-2 Product: 1,2-Bis(2,3-Dimethoxyphenyl)-2-Hydroxy-Ethanone No suppilers available for the product. |
| Name | 1,2-Bis(2,3-Dimethoxyphenyl)-2-Hydroxy-Ethanone |
|---|---|
| Synonyms | 1,2-Bis(2,3-Dimethoxyphenyl)-2-Hydroxy-Ethanone; Nsc26676; O-Veratroin |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 |
| CAS Registry Number | 5653-61-2 |
| SMILES | C1=CC=C(C(=C1C(=O)C(C2=C(C(=CC=C2)OC)OC)O)OC)OC |
| InChI | 1S/C18H20O6/c1-21-13-9-5-7-11(17(13)23-3)15(19)16(20)12-8-6-10-14(22-2)18(12)24-4/h5-10,15,19H,1-4H3 |
| InChIKey | OOCMVIWZLARXOS-UHFFFAOYSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.974°C at 760 mmHg (Cal.) |
| Flash point | 169.21°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Bis(2,3-Dimethoxyphenyl)-2-Hydroxy-Ethanone |