|
CAS#: 56564-72-8 Product: 2-Methyl-6-(1-Methylpropyl)Naphthalene No suppilers available for the product. |
| Name | 2-Methyl-6-(1-Methylpropyl)Naphthalene |
|---|---|
| Synonyms | 2-Methyl-6-Sec-Butyl-Naphthalene; 2-Methyl-6-Sec-Butylnaphthalene; 2-Butan-2-Yl-6-Methyl-Naphthalene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 |
| CAS Registry Number | 56564-72-8 |
| EINECS | 260-261-3 |
| SMILES | C1=C2C(=CC=C1C(CC)C)C=C(C=C2)C |
| InChI | 1S/C15H18/c1-4-12(3)13-7-8-14-9-11(2)5-6-15(14)10-13/h5-10,12H,4H2,1-3H3 |
| InChIKey | HFMRLGGSKFTVHE-UHFFFAOYSA-N |
| Density | 0.961g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.018°C at 760 mmHg (Cal.) |
| Flash point | 138.831°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-6-(1-Methylpropyl)Naphthalene |