|
CAS#: 5658-13-9 Product: Paratose No suppilers available for the product. |
| Name | Paratose |
|---|---|
| Synonyms | 3,6-Dideoxy-D-Ribo-Hexose; D-Ribo-Hexose, 3,6-Dideoxy-; Paratose |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 |
| CAS Registry Number | 5658-13-9 |
| SMILES | [C@H](C[C@H](C=O)O)([C@H](O)C)O |
| InChI | 1S/C6H12O4/c1-4(8)6(10)2-5(9)3-7/h3-6,8-10H,2H2,1H3/t4-,5-,6+/m1/s1 |
| InChIKey | GNTQICZXQYZQNE-PBXRRBTRSA-N |
| Density | 1.25g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.045°C at 760 mmHg (Cal.) |
| Flash point | 188.758°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Paratose |