|
CAS#: 5659-44-9 Product: 1,1,2,3,4-Pentachlorobuta-1,3-Diene No suppilers available for the product. |
| Name | 1,1,2,3,4-Pentachlorobuta-1,3-Diene |
|---|---|
| Synonyms | 1,1,2,3,4-Pentachlorobuta-1,3-Diene |
| Molecular Structure | ![]() |
| Molecular Formula | C4HCl5 |
| Molecular Weight | 226.32 |
| CAS Registry Number | 5659-44-9 |
| EINECS | 227-107-7 |
| SMILES | C(Cl)(\C(Cl)=C\Cl)=C(Cl)Cl |
| InChI | 1S/C4HCl5/c5-1-2(6)3(7)4(8)9/h1H/b2-1- |
| InChIKey | LMCCPYJNBKRUNQ-UPHRSURJSA-N |
| Density | 1.639g/cm3 (Cal.) |
|---|---|
| Boiling point | 222.213°C at 760 mmHg (Cal.) |
| Flash point | 90.157°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,3,4-Pentachlorobuta-1,3-Diene |