|
CAS#: 5667-11-8 Product: 2-Methyl-9H-pyrido[3,4-b]indolium iodide No suppilers available for the product. |
| Name | 2-Methyl-9H-pyrido[3,4-b]indolium iodide |
|---|---|
| Synonyms | 2-Methyl-4Ah-$B-Carbolin-9-Ium Iodide; 2-Menh; 2-Methylnorharman |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13IN2 |
| Molecular Weight | 312.15 |
| CAS Registry Number | 5667-11-8 |
| SMILES | C1=CC=CC3=C1C2C(=CN(C=C2)C)[NH2+]3.[I-] |
| InChI | 1S/C12H12N2.HI/c1-14-7-6-10-9-4-2-3-5-11(9)13-12(10)8-14;/h2-8,10,13H,1H3;1H |
| InChIKey | MARQLFJLMKVMKJ-UHFFFAOYSA-N |
| Boiling point | 300.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 142.2°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-9H-pyrido[3,4-b]indolium iodide |