|
CAS#: 5677-55-4 Product: Ubiquinol-10 No suppilers available for the product. |
| Name | Ubiquinol-10 |
|---|---|
| Synonyms | 2-(3,7-Dimethylocta-2,6-Dienyl)-5,6-Dimethoxy-3-Methylbenzene-1,4-Diol; 2-(3,7-Dimethylocta-2,6-Dienyl)-5,6-Dimethoxy-3-Methyl-Benzene-1,4-Diol; 2-[(2E)-3,7-Dimethylocta-2,6-Dienyl]-5,6-Dimethoxy-3-Methyl-Benzene-1,4-Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 |
| CAS Registry Number | 5677-55-4 (56275-39-9) |
| SMILES | C(C1=C(C(=C(OC)C(=C1O)OC)O)C)\C=C(\CCC=C(C)C)C |
| InChI | 1S/C19H28O4/c1-12(2)8-7-9-13(3)10-11-15-14(4)16(20)18(22-5)19(23-6)17(15)21/h8,10,20-21H,7,9,11H2,1-6H3/b13-10+ |
| InChIKey | RNUCUWWMTTWKAH-JLHYYAGUSA-N |
| Density | 1.06g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.984°C at 760 mmHg (Cal.) |
| Flash point | 250.133°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ubiquinol-10 |