|
CAS#: 56775-94-1 Product: 1-Acetyl-3-Acetoxy-5',5-Diphenylhydantoin No suppilers available for the product. |
| Name | 1-Acetyl-3-Acetoxy-5',5-Diphenylhydantoin |
|---|---|
| Synonyms | Acetic Acid [3-Acetyl-2,5-Dioxo-4,4-Di(Phenyl)-1-Imidazolidinyl] Ester; Acetic Acid [3-Acetyl-2,5-Diketo-4,4-Di(Phenyl)Imidazolidin-1-Yl] Ester; [3-Ethanoyl-2,5-Dioxo-4,4-Di(Phenyl)Imidazolidin-1-Yl] Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 |
| CAS Registry Number | 56775-94-1 |
| SMILES | C1=CC=CC=C1C2(N(C(N(C2=O)OC(C)=O)=O)C(C)=O)C3=CC=CC=C3 |
| InChI | 1S/C19H16N2O5/c1-13(22)20-18(25)21(26-14(2)23)17(24)19(20,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12H,1-2H3 |
| InChIKey | ZPIUYDNKYPLEMR-UHFFFAOYSA-N |
| Density | 1.392g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.225°C at 760 mmHg (Cal.) |
| Flash point | 241.207°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Acetyl-3-Acetoxy-5',5-Diphenylhydantoin |